C12H21NO6S2 — CID 107775675
(2R)-2-acetamido-3-(3-methylsulfonylcyclohexyl)sulfinylpropanoic acid (PubChem CID 107775675) has the molecular formula C12H21NO6S2 and a molecular weight of 339.44 g/mol. Its IUPAC name is (2R)-2-acetamido-3-(3-methylsulfonylcyclohexyl)sulfinylpropanoic acid.
| Compound Name | (2R)-2-acetamido-3-(3-methylsulfonylcyclohexyl)sulfinylpropanoic acid |
|---|---|
| PubChem CID | 107775675 |
| Molecular Formula | C12H21NO6S2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | (2R)-2-acetamido-3-(3-methylsulfonylcyclohexyl)sulfinylpropanoic acid |
| SMILES | CC(=O)N[C@@H](CS(=O)C1CCCC(S(C)(=O)=O)C1)C(=O)O |
| InChI | InChI=1S/C12H21NO6S2/c1-8(14)13-11(12(15)16)7-20(17)9-4-3-5-10(6-9)21(2,18)19/h9-11H,3-7H2,1-2H3,(H,13,14)(H,15,16)/t9?,10?,11-,20?/m0/s1 |
| InChIKey | PKDUXEPUYODFAF-DAXRKDLQSA-N |
| XLogP | -0.32 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |