About methyl 2-[1-(2,2-difluoroethylsulfanylmethyl)cyclopropyl]acetate
methyl 2-[1-(2,2-difluoroethylsulfanylmethyl)cyclopropyl]acetate (PubChem CID 107775989) has the molecular formula C9H14F2O2S
and a molecular weight of 224.27 g/mol. Its IUPAC name is methyl 2-[1-(2,2-difluoroethylsulfanylmethyl)cyclopropyl]acetate.
Analyze methyl 2-[1-(2,2-difluoroethylsulfanylmethyl)cyclopropyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[1-(2,2-difluoroethylsulfanylmethyl)cyclopropyl]acetate?
The IUPAC name of methyl 2-[1-(2,2-difluoroethylsulfanylmethyl)cyclopropyl]acetate (CID 107775989) is methyl 2-[1-(2,2-difluoroethylsulfanylmethyl)cyclopropyl]acetate.
What is the SMILES notation for methyl 2-[1-(2,2-difluoroethylsulfanylmethyl)cyclopropyl]acetate?
The canonical SMILES for methyl 2-[1-(2,2-difluoroethylsulfanylmethyl)cyclopropyl]acetate is COC(=O)CC1(CSCC(F)F)CC1.
What is the InChIKey of methyl 2-[1-(2,2-difluoroethylsulfanylmethyl)cyclopropyl]acetate?
The InChIKey is BQYPNAREFZTKEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14F2O2S/c1-13-8(12)4-9(2-3-9)6-14-5-7(10)11/h7H,2-6H2,1H3.
What are the key properties of methyl 2-[1-(2,2-difluoroethylsulfanylmethyl)cyclopropyl]acetate?
methyl 2-[1-(2,2-difluoroethylsulfanylmethyl)cyclopropyl]acetate has a molecular weight of 224.27 g/mol, XLogP of 2.33, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[1-(2,2-difluoroethylsulfanylmethyl)cyclopropyl]acetate is sourced from PubChem (CID 107775989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).