methyl 2-[1-(difluoromethylsulfanylmethyl)cyclopropyl]acetate

C8H12F2O2S — CID 107776063

IUPACmethyl 2-[1-(difluoromethylsulfanylmethyl)cyclopropyl]acetate
SMILESCOC(=O)CC1(CSC(F)F)CC1
InChIInChI=1S/C8H12F2O2S/c1-12-6(11)4-8(2-3-8)5-13-7(9)10/h7H,2-5H2,1H3
InChIKeyBUEVAJBDHWRSTP-UHFFFAOYSA-N
MW210.24 g/mol
LogP2.29
Rot. Bonds5

About methyl 2-[1-(difluoromethylsulfanylmethyl)cyclopropyl]acetate

methyl 2-[1-(difluoromethylsulfanylmethyl)cyclopropyl]acetate (PubChem CID 107776063) has the molecular formula C8H12F2O2S and a molecular weight of 210.24 g/mol. Its IUPAC name is methyl 2-[1-(difluoromethylsulfanylmethyl)cyclopropyl]acetate.

Molecular Properties

Compound Namemethyl 2-[1-(difluoromethylsulfanylmethyl)cyclopropyl]acetate
PubChem CID107776063
Molecular FormulaC8H12F2O2S
Molecular Weight210.24 g/mol
Exact Mass210.05
IUPAC Namemethyl 2-[1-(difluoromethylsulfanylmethyl)cyclopropyl]acetate
SMILESCOC(=O)CC1(CSC(F)F)CC1
InChIInChI=1S/C8H12F2O2S/c1-12-6(11)4-8(2-3-8)5-13-7(9)10/h7H,2-5H2,1H3
InChIKeyBUEVAJBDHWRSTP-UHFFFAOYSA-N
XLogP2.29
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500210.24
LogP ≤ 52.29
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 2-[1-(difluoromethylsulfanylmethyl)cyclopropyl]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[1-(difluoromethylsulfanylmethyl)cyclopropyl]acetate?
The IUPAC name of methyl 2-[1-(difluoromethylsulfanylmethyl)cyclopropyl]acetate (CID 107776063) is methyl 2-[1-(difluoromethylsulfanylmethyl)cyclopropyl]acetate.
What is the SMILES notation for methyl 2-[1-(difluoromethylsulfanylmethyl)cyclopropyl]acetate?
The canonical SMILES for methyl 2-[1-(difluoromethylsulfanylmethyl)cyclopropyl]acetate is COC(=O)CC1(CSC(F)F)CC1.
What is the InChIKey of methyl 2-[1-(difluoromethylsulfanylmethyl)cyclopropyl]acetate?
The InChIKey is BUEVAJBDHWRSTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12F2O2S/c1-12-6(11)4-8(2-3-8)5-13-7(9)10/h7H,2-5H2,1H3.
What are the key properties of methyl 2-[1-(difluoromethylsulfanylmethyl)cyclopropyl]acetate?
methyl 2-[1-(difluoromethylsulfanylmethyl)cyclopropyl]acetate has a molecular weight of 210.24 g/mol, XLogP of 2.29, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[1-(difluoromethylsulfanylmethyl)cyclopropyl]acetate is sourced from PubChem (CID 107776063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).