C11H17F3O3S — CID 107776475
methyl 2-[1-[2-(2,2,2-trifluoroethoxy)ethylsulfanylmethyl]cyclopropyl]acetate (PubChem CID 107776475) has the molecular formula C11H17F3O3S and a molecular weight of 286.31 g/mol. Its IUPAC name is methyl 2-[1-[2-(2,2,2-trifluoroethoxy)ethylsulfanylmethyl]cyclopropyl]acetate.
| Compound Name | methyl 2-[1-[2-(2,2,2-trifluoroethoxy)ethylsulfanylmethyl]cyclopropyl]acetate |
|---|---|
| PubChem CID | 107776475 |
| Molecular Formula | C11H17F3O3S |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | methyl 2-[1-[2-(2,2,2-trifluoroethoxy)ethylsulfanylmethyl]cyclopropyl]acetate |
| SMILES | COC(=O)CC1(CSCCOCC(F)(F)F)CC1 |
| InChI | InChI=1S/C11H17F3O3S/c1-16-9(15)6-10(2-3-10)8-18-5-4-17-7-11(12,13)14/h2-8H2,1H3 |
| InChIKey | HVLZFCXFMQRFAP-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|