C12H22F2O2S — CID 87340260
propyl 2-(3,3-difluoropropylsulfanyl)-4-methylpentanoate (PubChem CID 87340260) has the molecular formula C12H22F2O2S and a molecular weight of 268.37 g/mol. Its IUPAC name is propyl 2-(3,3-difluoropropylsulfanyl)-4-methylpentanoate.
| Compound Name | propyl 2-(3,3-difluoropropylsulfanyl)-4-methylpentanoate |
|---|---|
| PubChem CID | 87340260 |
| Molecular Formula | C12H22F2O2S |
| Molecular Weight | 268.37 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | propyl 2-(3,3-difluoropropylsulfanyl)-4-methylpentanoate |
| SMILES | CCCOC(=O)C(CC(C)C)SCCC(F)F |
| InChI | InChI=1S/C12H22F2O2S/c1-4-6-16-12(15)10(8-9(2)3)17-7-5-11(13)14/h9-11H,4-8H2,1-3H3 |
| InChIKey | RIBMZNDSIBVNKG-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.37 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |