C11H17F3O5S — CID 107776633
methyl 2-[1-[2-(2,2,2-trifluoroethoxy)ethylsulfonylmethyl]cyclopropyl]acetate (PubChem CID 107776633) has the molecular formula C11H17F3O5S and a molecular weight of 318.31 g/mol. Its IUPAC name is methyl 2-[1-[2-(2,2,2-trifluoroethoxy)ethylsulfonylmethyl]cyclopropyl]acetate.
| Compound Name | methyl 2-[1-[2-(2,2,2-trifluoroethoxy)ethylsulfonylmethyl]cyclopropyl]acetate |
|---|---|
| PubChem CID | 107776633 |
| Molecular Formula | C11H17F3O5S |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | methyl 2-[1-[2-(2,2,2-trifluoroethoxy)ethylsulfonylmethyl]cyclopropyl]acetate |
| SMILES | COC(=O)CC1(CS(=O)(=O)CCOCC(F)(F)F)CC1 |
| InChI | InChI=1S/C11H17F3O5S/c1-18-9(15)6-10(2-3-10)8-20(16,17)5-4-19-7-11(12,13)14/h2-8H2,1H3 |
| InChIKey | VSRKMVMOFRPZMD-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|