C13H24O5 — CID 10777741
(2R,3S)-3-[(4R)-2,2-diethyl-1,3-dioxolan-4-yl]-3-(methoxymethoxy)-2-methylpropanal (PubChem CID 10777741) has the molecular formula C13H24O5 and a molecular weight of 260.33 g/mol. Its IUPAC name is (2R,3S)-3-[(4R)-2,2-diethyl-1,3-dioxolan-4-yl]-3-(methoxymethoxy)-2-methylpropanal.
| Compound Name | (2R,3S)-3-[(4R)-2,2-diethyl-1,3-dioxolan-4-yl]-3-(methoxymethoxy)-2-methylpropanal |
|---|---|
| PubChem CID | 10777741 |
| Molecular Formula | C13H24O5 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | (2R,3S)-3-[(4R)-2,2-diethyl-1,3-dioxolan-4-yl]-3-(methoxymethoxy)-2-methylpropanal |
| SMILES | CCC1(CC)OC[C@H]([C@@H](OCOC)[C@@H](C)C=O)O1 |
| InChI | InChI=1S/C13H24O5/c1-5-13(6-2)17-8-11(18-13)12(10(3)7-14)16-9-15-4/h7,10-12H,5-6,8-9H2,1-4H3/t10-,11+,12-/m0/s1 |
| InChIKey | UEYUPPYNUAFPGZ-TUAOUCFPSA-N |
| XLogP | 1.74 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|