C7H5FN4S — CID 107780795
4-fluoro-6-(1H-imidazol-2-ylsulfanyl)pyrimidine (PubChem CID 107780795) has the molecular formula C7H5FN4S and a molecular weight of 196.21 g/mol. Its IUPAC name is 4-fluoro-6-(1H-imidazol-2-ylsulfanyl)pyrimidine.
| Compound Name | 4-fluoro-6-(1H-imidazol-2-ylsulfanyl)pyrimidine |
|---|---|
| PubChem CID | 107780795 |
| Molecular Formula | C7H5FN4S |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.02 |
| IUPAC Name | 4-fluoro-6-(1H-imidazol-2-ylsulfanyl)pyrimidine |
| SMILES | Fc1cc(Sc2ncc[nH]2)ncn1 |
| InChI | InChI=1S/C7H5FN4S/c8-5-3-6(12-4-11-5)13-7-9-1-2-10-7/h1-4H,(H,9,10) |
| InChIKey | WWRHLWHTISWUKW-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |