C13H14BrNOS — CID 107782525
2-bromo-N-[2-(2-methylfuran-3-yl)sulfanylethyl]aniline (PubChem CID 107782525) has the molecular formula C13H14BrNOS and a molecular weight of 312.23 g/mol. Its IUPAC name is 2-bromo-N-[2-(2-methylfuran-3-yl)sulfanylethyl]aniline.
| Compound Name | 2-bromo-N-[2-(2-methylfuran-3-yl)sulfanylethyl]aniline |
|---|---|
| PubChem CID | 107782525 |
| Molecular Formula | C13H14BrNOS |
| Molecular Weight | 312.23 g/mol |
| Exact Mass | 311.00 |
| IUPAC Name | 2-bromo-N-[2-(2-methylfuran-3-yl)sulfanylethyl]aniline |
| SMILES | Cc1occc1SCCNc1ccccc1Br |
| InChI | InChI=1S/C13H14BrNOS/c1-10-13(6-8-16-10)17-9-7-15-12-5-3-2-4-11(12)14/h2-6,8,15H,7,9H2,1H3 |
| InChIKey | AAEXNHJDGWVIOH-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.23 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|