C15H18BrN3S — CID 65041331
2-bromo-N-[2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylethyl]aniline (PubChem CID 65041331) has the molecular formula C15H18BrN3S and a molecular weight of 352.30 g/mol. Its IUPAC name is 2-bromo-N-[2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylethyl]aniline.
| Compound Name | 2-bromo-N-[2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylethyl]aniline |
|---|---|
| PubChem CID | 65041331 |
| Molecular Formula | C15H18BrN3S |
| Molecular Weight | 352.30 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | 2-bromo-N-[2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylethyl]aniline |
| SMILES | Cc1nc(SCCNc2ccccc2Br)nc(C)c1C |
| InChI | InChI=1S/C15H18BrN3S/c1-10-11(2)18-15(19-12(10)3)20-9-8-17-14-7-5-4-6-13(14)16/h4-7,17H,8-9H2,1-3H3 |
| InChIKey | MDWKMKMFGNLGIF-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.30 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|