About 2-bromo-N-[2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylethyl]aniline
2-bromo-N-[2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylethyl]aniline (PubChem CID 65041331) has the molecular formula C15H18BrN3S
and a molecular weight of 352.30 g/mol. Its IUPAC name is 2-bromo-N-[2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylethyl]aniline.
Molecular Properties
| Compound Name | 2-bromo-N-[2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylethyl]aniline |
| PubChem CID | 65041331 |
| Molecular Formula | C15H18BrN3S |
| Molecular Weight | 352.30 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | 2-bromo-N-[2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylethyl]aniline |
| SMILES | Cc1nc(SCCNc2ccccc2Br)nc(C)c1C |
| InChI | InChI=1S/C15H18BrN3S/c1-10-11(2)18-15(19-12(10)3)20-9-8-17-14-7-5-4-6-13(14)16/h4-7,17H,8-9H2,1-3H3 |
| InChIKey | MDWKMKMFGNLGIF-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.30 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-N-[2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylethyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-N-[2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylethyl]aniline?
The IUPAC name of 2-bromo-N-[2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylethyl]aniline (CID 65041331) is 2-bromo-N-[2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylethyl]aniline.
What is the SMILES notation for 2-bromo-N-[2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylethyl]aniline?
The canonical SMILES for 2-bromo-N-[2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylethyl]aniline is Cc1nc(SCCNc2ccccc2Br)nc(C)c1C.
What is the InChIKey of 2-bromo-N-[2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylethyl]aniline?
The InChIKey is MDWKMKMFGNLGIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18BrN3S/c1-10-11(2)18-15(19-12(10)3)20-9-8-17-14-7-5-4-6-13(14)16/h4-7,17H,8-9H2,1-3H3.
What are the key properties of 2-bromo-N-[2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylethyl]aniline?
2-bromo-N-[2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylethyl]aniline has a molecular weight of 352.30 g/mol, XLogP of 4.37, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-N-[2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylethyl]aniline is sourced from PubChem (CID 65041331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).