C16H30OSi — CID 10778262
[(2R,4aS)-2-deuterio-2,3,4,4a,5,6,7,8-octahydronaphthalen-1-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 10778262) has the molecular formula C16H30OSi and a molecular weight of 267.51 g/mol. Its IUPAC name is [(2R,4aS)-2-deuterio-2,3,4,4a,5,6,7,8-octahydronaphthalen-1-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(2R,4aS)-2-deuterio-2,3,4,4a,5,6,7,8-octahydronaphthalen-1-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10778262 |
| Molecular Formula | C16H30OSi |
| Molecular Weight | 267.51 g/mol |
| Exact Mass | 267.21 |
| IUPAC Name | [(2R,4aS)-2-deuterio-2,3,4,4a,5,6,7,8-octahydronaphthalen-1-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | [2H][C@@H]1CC[C@@H]2CCCCC2=C1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H30OSi/c1-16(2,3)18(4,5)17-15-12-8-10-13-9-6-7-11-14(13)15/h13H,6-12H2,1-5H3/t13-/m0/s1/i12D/t12-,13+/m1 |
| InChIKey | FCOHUWVEYJHINF-GSKZYWRZSA-N |
| XLogP | 5.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.51 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|