C20H42OSi2 — CID 134939335
[(3S,6S)-3-butyl-2-methyl-6-triethylsilylcyclohexen-1-yl]oxy-trimethylsilane (PubChem CID 134939335) has the molecular formula C20H42OSi2 and a molecular weight of 354.73 g/mol. Its IUPAC name is [(3S,6S)-3-butyl-2-methyl-6-triethylsilylcyclohexen-1-yl]oxy-trimethylsilane.
| Compound Name | [(3S,6S)-3-butyl-2-methyl-6-triethylsilylcyclohexen-1-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 134939335 |
| Molecular Formula | C20H42OSi2 |
| Molecular Weight | 354.73 g/mol |
| Exact Mass | 354.28 |
| IUPAC Name | [(3S,6S)-3-butyl-2-methyl-6-triethylsilylcyclohexen-1-yl]oxy-trimethylsilane |
| SMILES | CCCC[C@H]1CC[C@H]([Si](CC)(CC)CC)C(O[Si](C)(C)C)=C1C |
| InChI | InChI=1S/C20H42OSi2/c1-9-13-14-18-15-16-19(23(10-2,11-3)12-4)20(17(18)5)21-22(6,7)8/h18-19H,9-16H2,1-8H3/t18-,19-/m0/s1 |
| InChIKey | GJNBNSUCLONBMG-OALUTQOASA-N |
| XLogP | 7.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.73 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|