C7H7F3N2O2S — CID 107782737
4,4,4-trifluoro-3-(1H-imidazol-2-ylsulfanyl)butanoic acid (PubChem CID 107782737) has the molecular formula C7H7F3N2O2S and a molecular weight of 240.21 g/mol. Its IUPAC name is 4,4,4-trifluoro-3-(1H-imidazol-2-ylsulfanyl)butanoic acid.
| Compound Name | 4,4,4-trifluoro-3-(1H-imidazol-2-ylsulfanyl)butanoic acid |
|---|---|
| PubChem CID | 107782737 |
| Molecular Formula | C7H7F3N2O2S |
| Molecular Weight | 240.21 g/mol |
| Exact Mass | 240.02 |
| IUPAC Name | 4,4,4-trifluoro-3-(1H-imidazol-2-ylsulfanyl)butanoic acid |
| SMILES | O=C(O)CC(Sc1ncc[nH]1)C(F)(F)F |
| InChI | InChI=1S/C7H7F3N2O2S/c8-7(9,10)4(3-5(13)14)15-6-11-1-2-12-6/h1-2,4H,3H2,(H,11,12)(H,13,14) |
| InChIKey | ASHZSMUILDWBOM-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.21 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |