C9H15N5O3S — CID 107782929
2-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]pentanehydrazide (PubChem CID 107782929) has the molecular formula C9H15N5O3S and a molecular weight of 273.32 g/mol. Its IUPAC name is 2-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]pentanehydrazide.
| Compound Name | 2-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]pentanehydrazide |
|---|---|
| PubChem CID | 107782929 |
| Molecular Formula | C9H15N5O3S |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 2-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]pentanehydrazide |
| SMILES | CCCC(Sc1nc(=O)c(=O)[nH]n1C)C(=O)NN |
| InChI | InChI=1S/C9H15N5O3S/c1-3-4-5(6(15)12-10)18-9-11-7(16)8(17)13-14(9)2/h5H,3-4,10H2,1-2H3,(H,12,15)(H,13,17) |
| InChIKey | KHZMRUJXVBOKSO-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 122.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|