C14H14F3N3S — CID 107783077
N-[[4-(1H-imidazol-2-ylsulfanyl)-3-(trifluoromethyl)phenyl]methyl]cyclopropanamine (PubChem CID 107783077) has the molecular formula C14H14F3N3S and a molecular weight of 313.35 g/mol. Its IUPAC name is N-[[4-(1H-imidazol-2-ylsulfanyl)-3-(trifluoromethyl)phenyl]methyl]cyclopropanamine.
| Compound Name | N-[[4-(1H-imidazol-2-ylsulfanyl)-3-(trifluoromethyl)phenyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 107783077 |
| Molecular Formula | C14H14F3N3S |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | N-[[4-(1H-imidazol-2-ylsulfanyl)-3-(trifluoromethyl)phenyl]methyl]cyclopropanamine |
| SMILES | FC(F)(F)c1cc(CNC2CC2)ccc1Sc1ncc[nH]1 |
| InChI | InChI=1S/C14H14F3N3S/c15-14(16,17)11-7-9(8-20-10-2-3-10)1-4-12(11)21-13-18-5-6-19-13/h1,4-7,10,20H,2-3,8H2,(H,18,19) |
| InChIKey | QXUGPQLLSFAJNO-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |