C14H16F3NO2 — CID 117221551
5-[(cyclopentylamino)methyl]-2-(trifluoromethyl)benzoic acid (PubChem CID 117221551) has the molecular formula C14H16F3NO2 and a molecular weight of 287.28 g/mol. Its IUPAC name is 5-[(cyclopentylamino)methyl]-2-(trifluoromethyl)benzoic acid.
| Compound Name | 5-[(cyclopentylamino)methyl]-2-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 117221551 |
| Molecular Formula | C14H16F3NO2 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 5-[(cyclopentylamino)methyl]-2-(trifluoromethyl)benzoic acid |
| SMILES | O=C(O)c1cc(CNC2CCCC2)ccc1C(F)(F)F |
| InChI | InChI=1S/C14H16F3NO2/c15-14(16,17)12-6-5-9(7-11(12)13(19)20)8-18-10-3-1-2-4-10/h5-7,10,18H,1-4,8H2,(H,19,20) |
| InChIKey | VCTSUHNKWRPJHA-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |