C14H11N3O3 — CID 10778369
4-(2-hydroxyphenyl)-1-phenyl-1,2,4-triazolidine-3,5-dione (PubChem CID 10778369) has the molecular formula C14H11N3O3 and a molecular weight of 269.26 g/mol. Its IUPAC name is 4-(2-hydroxyphenyl)-1-phenyl-1,2,4-triazolidine-3,5-dione.
| Compound Name | 4-(2-hydroxyphenyl)-1-phenyl-1,2,4-triazolidine-3,5-dione |
|---|---|
| PubChem CID | 10778369 |
| Molecular Formula | C14H11N3O3 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 4-(2-hydroxyphenyl)-1-phenyl-1,2,4-triazolidine-3,5-dione |
| SMILES | O=c1[nH]n(-c2ccccc2)c(=O)n1-c1ccccc1O |
| InChI | InChI=1S/C14H11N3O3/c18-12-9-5-4-8-11(12)16-13(19)15-17(14(16)20)10-6-2-1-3-7-10/h1-9,18H,(H,15,19) |
| InChIKey | WFZKPLXBBSEZMI-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 80.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |