C8H15N3OS — CID 107784074
1-(1H-imidazol-2-ylsulfanyl)-3-methoxy-N-methylpropan-2-amine (PubChem CID 107784074) has the molecular formula C8H15N3OS and a molecular weight of 201.29 g/mol. Its IUPAC name is 1-(1H-imidazol-2-ylsulfanyl)-3-methoxy-N-methylpropan-2-amine.
| Compound Name | 1-(1H-imidazol-2-ylsulfanyl)-3-methoxy-N-methylpropan-2-amine |
|---|---|
| PubChem CID | 107784074 |
| Molecular Formula | C8H15N3OS |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | 1-(1H-imidazol-2-ylsulfanyl)-3-methoxy-N-methylpropan-2-amine |
| SMILES | CNC(COC)CSc1ncc[nH]1 |
| InChI | InChI=1S/C8H15N3OS/c1-9-7(5-12-2)6-13-8-10-3-4-11-8/h3-4,7,9H,5-6H2,1-2H3,(H,10,11) |
| InChIKey | JHZJAWZAXWHIAI-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |