C10H10F3N5S — CID 107784981
N-ethyl-6-(1H-imidazol-2-ylsulfanyl)-2-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 107784981) has the molecular formula C10H10F3N5S and a molecular weight of 289.29 g/mol. Its IUPAC name is N-ethyl-6-(1H-imidazol-2-ylsulfanyl)-2-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | N-ethyl-6-(1H-imidazol-2-ylsulfanyl)-2-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 107784981 |
| Molecular Formula | C10H10F3N5S |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | N-ethyl-6-(1H-imidazol-2-ylsulfanyl)-2-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | CCNc1cc(Sc2ncc[nH]2)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C10H10F3N5S/c1-2-14-6-5-7(19-9-15-3-4-16-9)18-8(17-6)10(11,12)13/h3-5H,2H2,1H3,(H,15,16)(H,14,17,18) |
| InChIKey | PORLSDUKYHKENI-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |