C21H17N5OS2 — CID 1077883
2-[(11,12-dimethyl-10-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-5-yl)sulfanyl]-N-naphthalen-1-ylacetamide (PubChem CID 1077883) has the molecular formula C21H17N5OS2 and a molecular weight of 419.54 g/mol. Its IUPAC name is 2-[(11,12-dimethyl-10-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-5-yl)sulfanyl]-N-naphthalen-1-ylacetamide.
| Compound Name | 2-[(11,12-dimethyl-10-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-5-yl)sulfanyl]-N-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 1077883 |
| Molecular Formula | C21H17N5OS2 |
| Molecular Weight | 419.54 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | 2-[(11,12-dimethyl-10-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-5-yl)sulfanyl]-N-naphthalen-1-ylacetamide |
| SMILES | Cc1sc2ncn3c(SCC(=O)Nc4cccc5ccccc45)nnc3c2c1C |
| InChI | InChI=1S/C21H17N5OS2/c1-12-13(2)29-20-18(12)19-24-25-21(26(19)11-22-20)28-10-17(27)23-16-9-5-7-14-6-3-4-8-15(14)16/h3-9,11H,10H2,1-2H3,(H,23,27) |
| InChIKey | VEECUBUEZOUUNS-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.54 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |