C25H17N5OS2 — CID 1430316
N-naphthalen-1-yl-2-[(12-phenyl-10-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-5-yl)sulfanyl]acetamide (PubChem CID 1430316) has the molecular formula C25H17N5OS2 and a molecular weight of 467.58 g/mol. Its IUPAC name is N-naphthalen-1-yl-2-[(12-phenyl-10-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-5-yl)sulfanyl]acetamide.
| Compound Name | N-naphthalen-1-yl-2-[(12-phenyl-10-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-5-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 1430316 |
| Molecular Formula | C25H17N5OS2 |
| Molecular Weight | 467.58 g/mol |
| Exact Mass | 467.09 |
| IUPAC Name | N-naphthalen-1-yl-2-[(12-phenyl-10-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-5-yl)sulfanyl]acetamide |
| SMILES | O=C(CSc1nnc2c3c(-c4ccccc4)csc3ncn12)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C25H17N5OS2/c31-21(27-20-12-6-10-16-9-4-5-11-18(16)20)14-33-25-29-28-23-22-19(17-7-2-1-3-8-17)13-32-24(22)26-15-30(23)25/h1-13,15H,14H2,(H,27,31) |
| InChIKey | CJCMZQHZBMNBCZ-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.58 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |