C22H22N6O2S2 — CID 3193254
N'-[2-[(12-phenyl-10-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-5-yl)sulfanyl]acetyl]cyclohexanecarbohydrazide (PubChem CID 3193254) has the molecular formula C22H22N6O2S2 and a molecular weight of 466.59 g/mol. Its IUPAC name is N'-[2-[(12-phenyl-10-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-5-yl)sulfanyl]acetyl]cyclohexanecarbohydrazide.
| Compound Name | N'-[2-[(12-phenyl-10-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-5-yl)sulfanyl]acetyl]cyclohexanecarbohydrazide |
|---|---|
| PubChem CID | 3193254 |
| Molecular Formula | C22H22N6O2S2 |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | N'-[2-[(12-phenyl-10-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-5-yl)sulfanyl]acetyl]cyclohexanecarbohydrazide |
| SMILES | O=C(CSc1nnc2c3c(-c4ccccc4)csc3ncn12)NNC(=O)C1CCCCC1 |
| InChI | InChI=1S/C22H22N6O2S2/c29-17(24-26-20(30)15-9-5-2-6-10-15)12-32-22-27-25-19-18-16(14-7-3-1-4-8-14)11-31-21(18)23-13-28(19)22/h1,3-4,7-8,11,13,15H,2,5-6,9-10,12H2,(H,24,29)(H,26,30) |
| InChIKey | FOCXVICKBPVSGK-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 101.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|