C21H21N5OS2 — CID 3672827
1-(2-methylpiperidin-1-yl)-2-[(12-phenyl-10-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-5-yl)sulfanyl]ethanone (PubChem CID 3672827) has the molecular formula C21H21N5OS2 and a molecular weight of 423.57 g/mol. Its IUPAC name is 1-(2-methylpiperidin-1-yl)-2-[(12-phenyl-10-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-5-yl)sulfanyl]ethanone.
| Compound Name | 1-(2-methylpiperidin-1-yl)-2-[(12-phenyl-10-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-5-yl)sulfanyl]ethanone |
|---|---|
| PubChem CID | 3672827 |
| Molecular Formula | C21H21N5OS2 |
| Molecular Weight | 423.57 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 1-(2-methylpiperidin-1-yl)-2-[(12-phenyl-10-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-5-yl)sulfanyl]ethanone |
| SMILES | CC1CCCCN1C(=O)CSc1nnc2c3c(-c4ccccc4)csc3ncn12 |
| InChI | InChI=1S/C21H21N5OS2/c1-14-7-5-6-10-25(14)17(27)12-29-21-24-23-19-18-16(15-8-3-2-4-9-15)11-28-20(18)22-13-26(19)21/h2-4,8-9,11,13-14H,5-7,10,12H2,1H3 |
| InChIKey | LTRMHWIDYFURNW-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 63.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.57 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |