C18H16N6O4S2 — CID 3167624
2-[(11,12-dimethyl-10-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-5-yl)sulfanyl]-N-(4-methoxy-2-nitrophenyl)acetamide (PubChem CID 3167624) has the molecular formula C18H16N6O4S2 and a molecular weight of 444.50 g/mol. Its IUPAC name is 2-[(11,12-dimethyl-10-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-5-yl)sulfanyl]-N-(4-methoxy-2-nitrophenyl)acetamide.
| Compound Name | 2-[(11,12-dimethyl-10-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-5-yl)sulfanyl]-N-(4-methoxy-2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 3167624 |
| Molecular Formula | C18H16N6O4S2 |
| Molecular Weight | 444.50 g/mol |
| Exact Mass | 444.07 |
| IUPAC Name | 2-[(11,12-dimethyl-10-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-5-yl)sulfanyl]-N-(4-methoxy-2-nitrophenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CSc2nnc3c4c(C)c(C)sc4ncn23)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H16N6O4S2/c1-9-10(2)30-17-15(9)16-21-22-18(23(16)8-19-17)29-7-14(25)20-12-5-4-11(28-3)6-13(12)24(26)27/h4-6,8H,7H2,1-3H3,(H,20,25) |
| InChIKey | KSQJHKYNKQBZOR-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 124.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.50 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|