C13H12N6O2 — CID 10779388
2,6-dimethyl-4-(3-methyl-5-nitroimidazol-4-yl)-1,4-dihydropyridine-3,5-dicarbonitrile (PubChem CID 10779388) has the molecular formula C13H12N6O2 and a molecular weight of 284.28 g/mol. Its IUPAC name is 2,6-dimethyl-4-(3-methyl-5-nitroimidazol-4-yl)-1,4-dihydropyridine-3,5-dicarbonitrile.
| Compound Name | 2,6-dimethyl-4-(3-methyl-5-nitroimidazol-4-yl)-1,4-dihydropyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 10779388 |
| Molecular Formula | C13H12N6O2 |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 2,6-dimethyl-4-(3-methyl-5-nitroimidazol-4-yl)-1,4-dihydropyridine-3,5-dicarbonitrile |
| SMILES | CC1=C(C#N)C(c2c([N+](=O)[O-])ncn2C)C(C#N)=C(C)N1 |
| InChI | InChI=1S/C13H12N6O2/c1-7-9(4-14)11(10(5-15)8(2)17-7)12-13(19(20)21)16-6-18(12)3/h6,11,17H,1-3H3 |
| InChIKey | BBWMYZFMIYXKFK-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 120.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|