C18H23N5O9 — CID 10950484
3-O-ethyl 5-O-(3-nitrooxypropyl) 2,6-dimethyl-4-(3-methyl-5-nitroimidazol-4-yl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 10950484) has the molecular formula C18H23N5O9 and a molecular weight of 453.41 g/mol. Its IUPAC name is 3-O-ethyl 5-O-(3-nitrooxypropyl) 2,6-dimethyl-4-(3-methyl-5-nitroimidazol-4-yl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-ethyl 5-O-(3-nitrooxypropyl) 2,6-dimethyl-4-(3-methyl-5-nitroimidazol-4-yl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 10950484 |
| Molecular Formula | C18H23N5O9 |
| Molecular Weight | 453.41 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | 3-O-ethyl 5-O-(3-nitrooxypropyl) 2,6-dimethyl-4-(3-methyl-5-nitroimidazol-4-yl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCCCO[N+](=O)[O-])C1c1c([N+](=O)[O-])ncn1C |
| InChI | InChI=1S/C18H23N5O9/c1-5-30-17(24)12-10(2)20-11(3)13(18(25)31-7-6-8-32-23(28)29)14(12)15-16(22(26)27)19-9-21(15)4/h9,14,20H,5-8H2,1-4H3 |
| InChIKey | IALOKKVKTGMBEV-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 177.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.41 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|