C16H20N4O6 — CID 10992121
5-O-ethyl 3-O-methyl 2,6-dimethyl-4-(1-methyl-5-nitroimidazol-2-yl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 10992121) has the molecular formula C16H20N4O6 and a molecular weight of 364.36 g/mol. Its IUPAC name is 5-O-ethyl 3-O-methyl 2,6-dimethyl-4-(1-methyl-5-nitroimidazol-2-yl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-ethyl 3-O-methyl 2,6-dimethyl-4-(1-methyl-5-nitroimidazol-2-yl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 10992121 |
| Molecular Formula | C16H20N4O6 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 5-O-ethyl 3-O-methyl 2,6-dimethyl-4-(1-methyl-5-nitroimidazol-2-yl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(C)=C(C(=O)OC)C1c1ncc([N+](=O)[O-])n1C |
| InChI | InChI=1S/C16H20N4O6/c1-6-26-16(22)12-9(3)18-8(2)11(15(21)25-5)13(12)14-17-7-10(19(14)4)20(23)24/h7,13,18H,6H2,1-5H3 |
| InChIKey | QWBPAQXMHKYIOX-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 125.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|