C17H22N4O7 — CID 11025643
3-O-methyl 5-O-(3-nitrooxypropyl) 2,6-dimethyl-4-(3-methylimidazol-4-yl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 11025643) has the molecular formula C17H22N4O7 and a molecular weight of 394.38 g/mol. Its IUPAC name is 3-O-methyl 5-O-(3-nitrooxypropyl) 2,6-dimethyl-4-(3-methylimidazol-4-yl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-methyl 5-O-(3-nitrooxypropyl) 2,6-dimethyl-4-(3-methylimidazol-4-yl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 11025643 |
| Molecular Formula | C17H22N4O7 |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 3-O-methyl 5-O-(3-nitrooxypropyl) 2,6-dimethyl-4-(3-methylimidazol-4-yl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OCCCO[N+](=O)[O-])C1c1cncn1C |
| InChI | InChI=1S/C17H22N4O7/c1-10-13(16(22)26-4)15(12-8-18-9-20(12)3)14(11(2)19-10)17(23)27-6-5-7-28-21(24)25/h8-9,15,19H,5-7H2,1-4H3 |
| InChIKey | KRKZDWXAXWFIJW-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 134.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|