C16H20N4O7 — CID 11003400
3-O-methyl 5-O-(2-nitrooxyethyl) 2,6-dimethyl-4-(3-methylimidazol-4-yl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 11003400) has the molecular formula C16H20N4O7 and a molecular weight of 380.36 g/mol. Its IUPAC name is 3-O-methyl 5-O-(2-nitrooxyethyl) 2,6-dimethyl-4-(3-methylimidazol-4-yl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-methyl 5-O-(2-nitrooxyethyl) 2,6-dimethyl-4-(3-methylimidazol-4-yl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 11003400 |
| Molecular Formula | C16H20N4O7 |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 3-O-methyl 5-O-(2-nitrooxyethyl) 2,6-dimethyl-4-(3-methylimidazol-4-yl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OCCO[N+](=O)[O-])C1c1cncn1C |
| InChI | InChI=1S/C16H20N4O7/c1-9-12(15(21)25-4)14(11-7-17-8-19(11)3)13(10(2)18-9)16(22)26-5-6-27-20(23)24/h7-8,14,18H,5-6H2,1-4H3 |
| InChIKey | UGKYHXIKHXHVQD-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 134.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|