About 1-(4-bromo-2,3-dichlorophenyl)-5-ethyl-2,5-dimethylpiperazine
1-(4-bromo-2,3-dichlorophenyl)-5-ethyl-2,5-dimethylpiperazine (PubChem CID 107794409) has the molecular formula C14H19BrCl2N2
and a molecular weight of 366.13 g/mol. Its IUPAC name is 1-(4-bromo-2,3-dichlorophenyl)-5-ethyl-2,5-dimethylpiperazine.
Molecular Properties
| Compound Name | 1-(4-bromo-2,3-dichlorophenyl)-5-ethyl-2,5-dimethylpiperazine |
| PubChem CID | 107794409 |
| Molecular Formula | C14H19BrCl2N2 |
| Molecular Weight | 366.13 g/mol |
| Exact Mass | 364.01 |
| IUPAC Name | 1-(4-bromo-2,3-dichlorophenyl)-5-ethyl-2,5-dimethylpiperazine |
| SMILES | CCC1(C)CN(c2ccc(Br)c(Cl)c2Cl)C(C)CN1 |
| InChI | InChI=1S/C14H19BrCl2N2/c1-4-14(3)8-19(9(2)7-18-14)11-6-5-10(15)12(16)13(11)17/h5-6,9,18H,4,7-8H2,1-3H3 |
| InChIKey | LZMNZFBAOAYITA-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.13 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-bromo-2,3-dichlorophenyl)-5-ethyl-2,5-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-bromo-2,3-dichlorophenyl)-5-ethyl-2,5-dimethylpiperazine?
The IUPAC name of 1-(4-bromo-2,3-dichlorophenyl)-5-ethyl-2,5-dimethylpiperazine (CID 107794409) is 1-(4-bromo-2,3-dichlorophenyl)-5-ethyl-2,5-dimethylpiperazine.
What is the SMILES notation for 1-(4-bromo-2,3-dichlorophenyl)-5-ethyl-2,5-dimethylpiperazine?
The canonical SMILES for 1-(4-bromo-2,3-dichlorophenyl)-5-ethyl-2,5-dimethylpiperazine is CCC1(C)CN(c2ccc(Br)c(Cl)c2Cl)C(C)CN1.
What is the InChIKey of 1-(4-bromo-2,3-dichlorophenyl)-5-ethyl-2,5-dimethylpiperazine?
The InChIKey is LZMNZFBAOAYITA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19BrCl2N2/c1-4-14(3)8-19(9(2)7-18-14)11-6-5-10(15)12(16)13(11)17/h5-6,9,18H,4,7-8H2,1-3H3.
What are the key properties of 1-(4-bromo-2,3-dichlorophenyl)-5-ethyl-2,5-dimethylpiperazine?
1-(4-bromo-2,3-dichlorophenyl)-5-ethyl-2,5-dimethylpiperazine has a molecular weight of 366.13 g/mol, XLogP of 4.72, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-bromo-2,3-dichlorophenyl)-5-ethyl-2,5-dimethylpiperazine is sourced from PubChem (CID 107794409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).