C18H23BrN2 — CID 81267340
1-(6-bromonaphthalen-2-yl)-5-ethyl-2,5-dimethylpiperazine (PubChem CID 81267340) has the molecular formula C18H23BrN2 and a molecular weight of 347.30 g/mol. Its IUPAC name is 1-(6-bromonaphthalen-2-yl)-5-ethyl-2,5-dimethylpiperazine.
| Compound Name | 1-(6-bromonaphthalen-2-yl)-5-ethyl-2,5-dimethylpiperazine |
|---|---|
| PubChem CID | 81267340 |
| Molecular Formula | C18H23BrN2 |
| Molecular Weight | 347.30 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 1-(6-bromonaphthalen-2-yl)-5-ethyl-2,5-dimethylpiperazine |
| SMILES | CCC1(C)CN(c2ccc3cc(Br)ccc3c2)C(C)CN1 |
| InChI | InChI=1S/C18H23BrN2/c1-4-18(3)12-21(13(2)11-20-18)17-8-6-14-9-16(19)7-5-15(14)10-17/h5-10,13,20H,4,11-12H2,1-3H3 |
| InChIKey | YHDSWUDRSZVYRJ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.30 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |