C18H31N3 — CID 64941181
N,N-diethyl-4-(5-ethyl-2,5-dimethylpiperazin-1-yl)aniline (PubChem CID 64941181) has the molecular formula C18H31N3 and a molecular weight of 289.47 g/mol. Its IUPAC name is N,N-diethyl-4-(5-ethyl-2,5-dimethylpiperazin-1-yl)aniline.
| Compound Name | N,N-diethyl-4-(5-ethyl-2,5-dimethylpiperazin-1-yl)aniline |
|---|---|
| PubChem CID | 64941181 |
| Molecular Formula | C18H31N3 |
| Molecular Weight | 289.47 g/mol |
| Exact Mass | 289.25 |
| IUPAC Name | N,N-diethyl-4-(5-ethyl-2,5-dimethylpiperazin-1-yl)aniline |
| SMILES | CCN(CC)c1ccc(N2CC(C)(CC)NCC2C)cc1 |
| InChI | InChI=1S/C18H31N3/c1-6-18(5)14-21(15(4)13-19-18)17-11-9-16(10-12-17)20(7-2)8-3/h9-12,15,19H,6-8,13-14H2,1-5H3 |
| InChIKey | ZDPGSLPQHJJMKW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.47 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|