C19H29NO — CID 10779674
(2Z,6E)-2-[(E)-5-hydroxy-4-methylpent-3-enyl]-6,10-dimethylundeca-2,6,10-trienenitrile (PubChem CID 10779674) has the molecular formula C19H29NO and a molecular weight of 287.45 g/mol. Its IUPAC name is (2Z,6E)-2-[(E)-5-hydroxy-4-methylpent-3-enyl]-6,10-dimethylundeca-2,6,10-trienenitrile.
| Compound Name | (2Z,6E)-2-[(E)-5-hydroxy-4-methylpent-3-enyl]-6,10-dimethylundeca-2,6,10-trienenitrile |
|---|---|
| PubChem CID | 10779674 |
| Molecular Formula | C19H29NO |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | (2Z,6E)-2-[(E)-5-hydroxy-4-methylpent-3-enyl]-6,10-dimethylundeca-2,6,10-trienenitrile |
| SMILES | C=C(C)CC/C=C(\C)CC/C=C(\C#N)CC/C=C(\C)CO |
| InChI | InChI=1S/C19H29NO/c1-16(2)8-5-9-17(3)10-6-12-19(14-20)13-7-11-18(4)15-21/h9,11-12,21H,1,5-8,10,13,15H2,2-4H3/b17-9+,18-11+,19-12- |
| InChIKey | DCUCZLBPGPSTTC-NRHUANECSA-N |
| XLogP | 5.24 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|