C16H13BrN2O2 — CID 107797709
2-[1-(1,3-benzodioxol-5-yl)ethylamino]-4-bromobenzonitrile (PubChem CID 107797709) has the molecular formula C16H13BrN2O2 and a molecular weight of 345.20 g/mol. Its IUPAC name is 2-[1-(1,3-benzodioxol-5-yl)ethylamino]-4-bromobenzonitrile.
| Compound Name | 2-[1-(1,3-benzodioxol-5-yl)ethylamino]-4-bromobenzonitrile |
|---|---|
| PubChem CID | 107797709 |
| Molecular Formula | C16H13BrN2O2 |
| Molecular Weight | 345.20 g/mol |
| Exact Mass | 344.02 |
| IUPAC Name | 2-[1-(1,3-benzodioxol-5-yl)ethylamino]-4-bromobenzonitrile |
| SMILES | CC(Nc1cc(Br)ccc1C#N)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H13BrN2O2/c1-10(11-3-5-15-16(6-11)21-9-20-15)19-14-7-13(17)4-2-12(14)8-18/h2-7,10,19H,9H2,1H3 |
| InChIKey | SJFKLIULLZQMJX-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.20 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |