C13H10BrN5S — CID 107799498
4-bromo-2-(1,3-dimethyl-5-sulfanylidene-4H-imidazo[4,5-d]pyrazol-6-yl)benzonitrile (PubChem CID 107799498) has the molecular formula C13H10BrN5S and a molecular weight of 348.23 g/mol. Its IUPAC name is 4-bromo-2-(1,3-dimethyl-5-sulfanylidene-4H-imidazo[4,5-d]pyrazol-6-yl)benzonitrile.
| Compound Name | 4-bromo-2-(1,3-dimethyl-5-sulfanylidene-4H-imidazo[4,5-d]pyrazol-6-yl)benzonitrile |
|---|---|
| PubChem CID | 107799498 |
| Molecular Formula | C13H10BrN5S |
| Molecular Weight | 348.23 g/mol |
| Exact Mass | 346.98 |
| IUPAC Name | 4-bromo-2-(1,3-dimethyl-5-sulfanylidene-4H-imidazo[4,5-d]pyrazol-6-yl)benzonitrile |
| SMILES | Cc1nn(C)c2c1[nH]c(=S)n2-c1cc(Br)ccc1C#N |
| InChI | InChI=1S/C13H10BrN5S/c1-7-11-12(18(2)17-7)19(13(20)16-11)10-5-9(14)4-3-8(10)6-15/h3-5H,1-2H3,(H,16,20) |
| InChIKey | UKJLXPDKJHAWMB-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 62.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.23 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|