C14H18F2O3S — CID 10780819
S-tert-butyl 2,2-difluoro-3-hydroxy-3-(4-methoxyphenyl)propanethioate (PubChem CID 10780819) has the molecular formula C14H18F2O3S and a molecular weight of 304.36 g/mol. Its IUPAC name is S-tert-butyl 2,2-difluoro-3-hydroxy-3-(4-methoxyphenyl)propanethioate.
| Compound Name | S-tert-butyl 2,2-difluoro-3-hydroxy-3-(4-methoxyphenyl)propanethioate |
|---|---|
| PubChem CID | 10780819 |
| Molecular Formula | C14H18F2O3S |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | S-tert-butyl 2,2-difluoro-3-hydroxy-3-(4-methoxyphenyl)propanethioate |
| SMILES | COc1ccc(C(O)C(F)(F)C(=O)SC(C)(C)C)cc1 |
| InChI | InChI=1S/C14H18F2O3S/c1-13(2,3)20-12(18)14(15,16)11(17)9-5-7-10(19-4)8-6-9/h5-8,11,17H,1-4H3 |
| InChIKey | AYKUWLKWSPCHBS-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|