C14H17F2NO2S2 — CID 132565595
[1,1-difluoro-2-hydroxy-2-(4-methoxyphenyl)ethyl] pyrrolidine-1-carbodithioate (PubChem CID 132565595) has the molecular formula C14H17F2NO2S2 and a molecular weight of 333.43 g/mol. Its IUPAC name is [1,1-difluoro-2-hydroxy-2-(4-methoxyphenyl)ethyl] pyrrolidine-1-carbodithioate.
| Compound Name | [1,1-difluoro-2-hydroxy-2-(4-methoxyphenyl)ethyl] pyrrolidine-1-carbodithioate |
|---|---|
| PubChem CID | 132565595 |
| Molecular Formula | C14H17F2NO2S2 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | [1,1-difluoro-2-hydroxy-2-(4-methoxyphenyl)ethyl] pyrrolidine-1-carbodithioate |
| SMILES | COc1ccc(C(O)C(F)(F)SC(=S)N2CCCC2)cc1 |
| InChI | InChI=1S/C14H17F2NO2S2/c1-19-11-6-4-10(5-7-11)12(18)14(15,16)21-13(20)17-8-2-3-9-17/h4-7,12,18H,2-3,8-9H2,1H3 |
| InChIKey | PMUGUZFJBWSZGV-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|