C12H8BrF3O — CID 10780875
(3E,5E)-6-(4-bromophenyl)-1,1,1-trifluorohexa-3,5-dien-2-one (PubChem CID 10780875) has the molecular formula C12H8BrF3O and a molecular weight of 305.09 g/mol. Its IUPAC name is (3E,5E)-6-(4-bromophenyl)-1,1,1-trifluorohexa-3,5-dien-2-one.
| Compound Name | (3E,5E)-6-(4-bromophenyl)-1,1,1-trifluorohexa-3,5-dien-2-one |
|---|---|
| PubChem CID | 10780875 |
| Molecular Formula | C12H8BrF3O |
| Molecular Weight | 305.09 g/mol |
| Exact Mass | 303.97 |
| IUPAC Name | (3E,5E)-6-(4-bromophenyl)-1,1,1-trifluorohexa-3,5-dien-2-one |
| SMILES | O=C(/C=C/C=C/c1ccc(Br)cc1)C(F)(F)F |
| InChI | InChI=1S/C12H8BrF3O/c13-10-7-5-9(6-8-10)3-1-2-4-11(17)12(14,15)16/h1-8H/b3-1+,4-2+ |
| InChIKey | JJNJTGCRVNINME-ZPUQHVIOSA-N |
| XLogP | 4.15 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.09 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|