C12H14F3NO3S — CID 143172848
ethane;4-[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]benzenesulfonamide (PubChem CID 143172848) has the molecular formula C12H14F3NO3S and a molecular weight of 309.31 g/mol. Its IUPAC name is ethane;4-[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]benzenesulfonamide.
| Compound Name | ethane;4-[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]benzenesulfonamide |
|---|---|
| PubChem CID | 143172848 |
| Molecular Formula | C12H14F3NO3S |
| Molecular Weight | 309.31 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | ethane;4-[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]benzenesulfonamide |
| SMILES | CC.NS(=O)(=O)c1ccc(/C=C/C(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H8F3NO3S.C2H6/c11-10(12,13)9(15)6-3-7-1-4-8(5-2-7)18(14,16)17;1-2/h1-6H,(H2,14,16,17);1-2H3/b6-3+; |
| InChIKey | LQGYZHFCLPACBT-ZIKNSQGESA-N |
| XLogP | 2.50 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|