C13H15N3O3 — CID 107810831
2-cyano-N-(2-methyl-3-nitrophenyl)pentanamide (PubChem CID 107810831) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is 2-cyano-N-(2-methyl-3-nitrophenyl)pentanamide.
| Compound Name | 2-cyano-N-(2-methyl-3-nitrophenyl)pentanamide |
|---|---|
| PubChem CID | 107810831 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 2-cyano-N-(2-methyl-3-nitrophenyl)pentanamide |
| SMILES | CCCC(C#N)C(=O)Nc1cccc([N+](=O)[O-])c1C |
| InChI | InChI=1S/C13H15N3O3/c1-3-5-10(8-14)13(17)15-11-6-4-7-12(9(11)2)16(18)19/h4,6-7,10H,3,5H2,1-2H3,(H,15,17) |
| InChIKey | GXCOPYJVXWYBRE-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|