C16H16N4O — CID 107811636
5-[3-[(2-methylphenyl)methyl]-1,2,4-oxadiazol-5-yl]benzene-1,3-diamine (PubChem CID 107811636) has the molecular formula C16H16N4O and a molecular weight of 280.33 g/mol. Its IUPAC name is 5-[3-[(2-methylphenyl)methyl]-1,2,4-oxadiazol-5-yl]benzene-1,3-diamine.
| Compound Name | 5-[3-[(2-methylphenyl)methyl]-1,2,4-oxadiazol-5-yl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 107811636 |
| Molecular Formula | C16H16N4O |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 5-[3-[(2-methylphenyl)methyl]-1,2,4-oxadiazol-5-yl]benzene-1,3-diamine |
| SMILES | Cc1ccccc1Cc1noc(-c2cc(N)cc(N)c2)n1 |
| InChI | InChI=1S/C16H16N4O/c1-10-4-2-3-5-11(10)8-15-19-16(21-20-15)12-6-13(17)9-14(18)7-12/h2-7,9H,8,17-18H2,1H3 |
| InChIKey | DYHLZWFEDMGUEC-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 90.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|