C10H9ClN2O — CID 62596855
5-chloro-3-[(2-methylphenyl)methyl]-1,2,4-oxadiazole (PubChem CID 62596855) has the molecular formula C10H9ClN2O and a molecular weight of 208.65 g/mol. Its IUPAC name is 5-chloro-3-[(2-methylphenyl)methyl]-1,2,4-oxadiazole.
| Compound Name | 5-chloro-3-[(2-methylphenyl)methyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 62596855 |
| Molecular Formula | C10H9ClN2O |
| Molecular Weight | 208.65 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | 5-chloro-3-[(2-methylphenyl)methyl]-1,2,4-oxadiazole |
| SMILES | Cc1ccccc1Cc1noc(Cl)n1 |
| InChI | InChI=1S/C10H9ClN2O/c1-7-4-2-3-5-8(7)6-9-12-10(11)14-13-9/h2-5H,6H2,1H3 |
| InChIKey | IMIZGZLHQOQIHF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.65 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |