C11H10N2O2 — CID 63771150
3-[(2-methylphenyl)methyl]-1,2,4-oxadiazole-5-carbaldehyde (PubChem CID 63771150) has the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. Its IUPAC name is 3-[(2-methylphenyl)methyl]-1,2,4-oxadiazole-5-carbaldehyde.
| Compound Name | 3-[(2-methylphenyl)methyl]-1,2,4-oxadiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 63771150 |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 3-[(2-methylphenyl)methyl]-1,2,4-oxadiazole-5-carbaldehyde |
| SMILES | Cc1ccccc1Cc1noc(C=O)n1 |
| InChI | InChI=1S/C11H10N2O2/c1-8-4-2-3-5-9(8)6-10-12-11(7-14)15-13-10/h2-5,7H,6H2,1H3 |
| InChIKey | PWIIZAAFKBOCNN-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|