About 3-(pyridin-4-ylmethyl)-1,2,4-oxadiazole-5-carbaldehyde
3-(pyridin-4-ylmethyl)-1,2,4-oxadiazole-5-carbaldehyde (PubChem CID 63770981) has the molecular formula C9H7N3O2
and a molecular weight of 189.17 g/mol. Its IUPAC name is 3-(pyridin-4-ylmethyl)-1,2,4-oxadiazole-5-carbaldehyde.
Molecular Properties
| Compound Name | 3-(pyridin-4-ylmethyl)-1,2,4-oxadiazole-5-carbaldehyde |
| PubChem CID | 63770981 |
| Molecular Formula | C9H7N3O2 |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.05 |
| IUPAC Name | 3-(pyridin-4-ylmethyl)-1,2,4-oxadiazole-5-carbaldehyde |
| SMILES | O=Cc1nc(Cc2ccncc2)no1 |
| InChI | InChI=1S/C9H7N3O2/c13-6-9-11-8(12-14-9)5-7-1-3-10-4-2-7/h1-4,6H,5H2 |
| InChIKey | FHDVSFDMVQVIQH-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 68.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-(pyridin-4-ylmethyl)-1,2,4-oxadiazole-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(pyridin-4-ylmethyl)-1,2,4-oxadiazole-5-carbaldehyde?
The IUPAC name of 3-(pyridin-4-ylmethyl)-1,2,4-oxadiazole-5-carbaldehyde (CID 63770981) is 3-(pyridin-4-ylmethyl)-1,2,4-oxadiazole-5-carbaldehyde.
What is the SMILES notation for 3-(pyridin-4-ylmethyl)-1,2,4-oxadiazole-5-carbaldehyde?
The canonical SMILES for 3-(pyridin-4-ylmethyl)-1,2,4-oxadiazole-5-carbaldehyde is O=Cc1nc(Cc2ccncc2)no1.
What is the InChIKey of 3-(pyridin-4-ylmethyl)-1,2,4-oxadiazole-5-carbaldehyde?
The InChIKey is FHDVSFDMVQVIQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N3O2/c13-6-9-11-8(12-14-9)5-7-1-3-10-4-2-7/h1-4,6H,5H2.
What are the key properties of 3-(pyridin-4-ylmethyl)-1,2,4-oxadiazole-5-carbaldehyde?
3-(pyridin-4-ylmethyl)-1,2,4-oxadiazole-5-carbaldehyde has a molecular weight of 189.17 g/mol, XLogP of 0.87, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(pyridin-4-ylmethyl)-1,2,4-oxadiazole-5-carbaldehyde is sourced from PubChem (CID 63770981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).