C9H7N3O2 — CID 63770981
3-(pyridin-4-ylmethyl)-1,2,4-oxadiazole-5-carbaldehyde (PubChem CID 63770981) has the molecular formula C9H7N3O2 and a molecular weight of 189.17 g/mol. Its IUPAC name is 3-(pyridin-4-ylmethyl)-1,2,4-oxadiazole-5-carbaldehyde.
| Compound Name | 3-(pyridin-4-ylmethyl)-1,2,4-oxadiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 63770981 |
| Molecular Formula | C9H7N3O2 |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.05 |
| IUPAC Name | 3-(pyridin-4-ylmethyl)-1,2,4-oxadiazole-5-carbaldehyde |
| SMILES | O=Cc1nc(Cc2ccncc2)no1 |
| InChI | InChI=1S/C9H7N3O2/c13-6-9-11-8(12-14-9)5-7-1-3-10-4-2-7/h1-4,6H,5H2 |
| InChIKey | FHDVSFDMVQVIQH-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 68.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|