C10H14N6 — CID 107811849
5-[4-methyl-5-(methylamino)-1,2,4-triazol-3-yl]benzene-1,3-diamine (PubChem CID 107811849) has the molecular formula C10H14N6 and a molecular weight of 218.26 g/mol. Its IUPAC name is 5-[4-methyl-5-(methylamino)-1,2,4-triazol-3-yl]benzene-1,3-diamine.
| Compound Name | 5-[4-methyl-5-(methylamino)-1,2,4-triazol-3-yl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 107811849 |
| Molecular Formula | C10H14N6 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 5-[4-methyl-5-(methylamino)-1,2,4-triazol-3-yl]benzene-1,3-diamine |
| SMILES | CNc1nnc(-c2cc(N)cc(N)c2)n1C |
| InChI | InChI=1S/C10H14N6/c1-13-10-15-14-9(16(10)2)6-3-7(11)5-8(12)4-6/h3-5H,11-12H2,1-2H3,(H,13,15) |
| InChIKey | BVDKLHLPWUPPMT-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 94.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|