C10H12N6O2 — CID 112597091
5-(2-amino-5-nitrophenyl)-N,4-dimethyl-1,2,4-triazol-3-amine (PubChem CID 112597091) has the molecular formula C10H12N6O2 and a molecular weight of 248.25 g/mol. Its IUPAC name is 5-(2-amino-5-nitrophenyl)-N,4-dimethyl-1,2,4-triazol-3-amine.
| Compound Name | 5-(2-amino-5-nitrophenyl)-N,4-dimethyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 112597091 |
| Molecular Formula | C10H12N6O2 |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 5-(2-amino-5-nitrophenyl)-N,4-dimethyl-1,2,4-triazol-3-amine |
| SMILES | CNc1nnc(-c2cc([N+](=O)[O-])ccc2N)n1C |
| InChI | InChI=1S/C10H12N6O2/c1-12-10-14-13-9(15(10)2)7-5-6(16(17)18)3-4-8(7)11/h3-5H,11H2,1-2H3,(H,12,14) |
| InChIKey | VDXYLFPTAGKXAF-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|