C10H11N5O4S — CID 113366508
4-methyl-5-(2-methyl-5-nitrophenyl)-1,2,4-triazole-3-sulfonamide (PubChem CID 113366508) has the molecular formula C10H11N5O4S and a molecular weight of 297.30 g/mol. Its IUPAC name is 4-methyl-5-(2-methyl-5-nitrophenyl)-1,2,4-triazole-3-sulfonamide.
| Compound Name | 4-methyl-5-(2-methyl-5-nitrophenyl)-1,2,4-triazole-3-sulfonamide |
|---|---|
| PubChem CID | 113366508 |
| Molecular Formula | C10H11N5O4S |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 4-methyl-5-(2-methyl-5-nitrophenyl)-1,2,4-triazole-3-sulfonamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1-c1nnc(S(N)(=O)=O)n1C |
| InChI | InChI=1S/C10H11N5O4S/c1-6-3-4-7(15(16)17)5-8(6)9-12-13-10(14(9)2)20(11,18)19/h3-5H,1-2H3,(H2,11,18,19) |
| InChIKey | ROANDPREYNVFQR-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 134.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|