C14H20Cl2N2O2 — CID 107816572
4,5-dichloro-N-(2-ethylhexyl)-2-nitroaniline (PubChem CID 107816572) has the molecular formula C14H20Cl2N2O2 and a molecular weight of 319.23 g/mol. Its IUPAC name is 4,5-dichloro-N-(2-ethylhexyl)-2-nitroaniline.
| Compound Name | 4,5-dichloro-N-(2-ethylhexyl)-2-nitroaniline |
|---|---|
| PubChem CID | 107816572 |
| Molecular Formula | C14H20Cl2N2O2 |
| Molecular Weight | 319.23 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 4,5-dichloro-N-(2-ethylhexyl)-2-nitroaniline |
| SMILES | CCCCC(CC)CNc1cc(Cl)c(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H20Cl2N2O2/c1-3-5-6-10(4-2)9-17-13-7-11(15)12(16)8-14(13)18(19)20/h7-8,10,17H,3-6,9H2,1-2H3 |
| InChIKey | AFNQGKXLPOYYDZ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.23 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|