C20H30O3 — CID 10781843
(1R,5R,8R,8aS)-8-hydroxy-5,8a-dimethyl-5-(4-methylpent-3-enyl)-1,4,4a,6,7,8-hexahydronaphthalene-1,2-dicarbaldehyde (PubChem CID 10781843) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (1R,5R,8R,8aS)-8-hydroxy-5,8a-dimethyl-5-(4-methylpent-3-enyl)-1,4,4a,6,7,8-hexahydronaphthalene-1,2-dicarbaldehyde.
| Compound Name | (1R,5R,8R,8aS)-8-hydroxy-5,8a-dimethyl-5-(4-methylpent-3-enyl)-1,4,4a,6,7,8-hexahydronaphthalene-1,2-dicarbaldehyde |
|---|---|
| PubChem CID | 10781843 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (1R,5R,8R,8aS)-8-hydroxy-5,8a-dimethyl-5-(4-methylpent-3-enyl)-1,4,4a,6,7,8-hexahydronaphthalene-1,2-dicarbaldehyde |
| SMILES | CC(C)=CCC[C@]1(C)CC[C@@H](O)[C@@]2(C)C1CC=C(C=O)[C@@H]2C=O |
| InChI | InChI=1S/C20H30O3/c1-14(2)6-5-10-19(3)11-9-18(23)20(4)16(13-22)15(12-21)7-8-17(19)20/h6-7,12-13,16-18,23H,5,8-11H2,1-4H3/t16-,17?,18+,19+,20+/m0/s1 |
| InChIKey | NHYBPWAMQZZGHQ-BUWZGVTHSA-N |
| XLogP | 3.86 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|