C20H29ClO3 — CID 162888735
(1R,4aR,5S,6S,8S,8aS)-6-chloro-8-hydroxy-5,8a-dimethyl-5-(4-methylpent-3-enyl)-1,4,4a,6,7,8-hexahydronaphthalene-1,2-dicarbaldehyde (PubChem CID 162888735) has the molecular formula C20H29ClO3 and a molecular weight of 352.90 g/mol. Its IUPAC name is (1R,4aR,5S,6S,8S,8aS)-6-chloro-8-hydroxy-5,8a-dimethyl-5-(4-methylpent-3-enyl)-1,4,4a,6,7,8-hexahydronaphthalene-1,2-dicarbaldehyde.
| Compound Name | (1R,4aR,5S,6S,8S,8aS)-6-chloro-8-hydroxy-5,8a-dimethyl-5-(4-methylpent-3-enyl)-1,4,4a,6,7,8-hexahydronaphthalene-1,2-dicarbaldehyde |
|---|---|
| PubChem CID | 162888735 |
| Molecular Formula | C20H29ClO3 |
| Molecular Weight | 352.90 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | (1R,4aR,5S,6S,8S,8aS)-6-chloro-8-hydroxy-5,8a-dimethyl-5-(4-methylpent-3-enyl)-1,4,4a,6,7,8-hexahydronaphthalene-1,2-dicarbaldehyde |
| SMILES | CC(C)=CCC[C@]1(C)[C@@H](Cl)C[C@H](O)[C@]2(C)[C@@H](C=O)C(C=O)=CC[C@@H]12 |
| InChI | InChI=1S/C20H29ClO3/c1-13(2)6-5-9-19(3)16-8-7-14(11-22)15(12-23)20(16,4)18(24)10-17(19)21/h6-7,11-12,15-18,24H,5,8-10H2,1-4H3/t15-,16-,17-,18-,19-,20+/m0/s1 |
| InChIKey | PVWNALVHQUKYII-RPZLJYRGSA-N |
| XLogP | 4.08 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.90 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|